C27H26F3N5O3 — CID 129271576
N-[3-[(11S)-8-ethyl-9-oxo-13-oxa-1,6,8-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-4-yl]-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide (PubChem CID 129271576) has the molecular formula C27H26F3N5O3 and a molecular weight of 525.53 g/mol. Its IUPAC name is N-[3-[(11S)-8-ethyl-9-oxo-13-oxa-1,6,8-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-4-yl]-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide.
| Compound Name | N-[3-[(11S)-8-ethyl-9-oxo-13-oxa-1,6,8-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-4-yl]-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 129271576 |
| Molecular Formula | C27H26F3N5O3 |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | N-[3-[(11S)-8-ethyl-9-oxo-13-oxa-1,6,8-triazatricyclo[9.4.0.02,7]pentadeca-2(7),3,5-trien-4-yl]-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
| SMILES | CCN1C(=O)C[C@H]2COCCN2c2cc(-c3cc(NC(=O)c4ccnc(C(F)(F)F)c4)ccc3C)cnc21 |
| InChI | InChI=1S/C27H26F3N5O3/c1-3-34-24(36)13-20-15-38-9-8-35(20)22-10-18(14-32-25(22)34)21-12-19(5-4-16(21)2)33-26(37)17-6-7-31-23(11-17)27(28,29)30/h4-7,10-12,14,20H,3,8-9,13,15H2,1-2H3,(H,33,37)/t20-/m0/s1 |
| InChIKey | LVXBAQVWDPHRHW-FQEVSTJZSA-N |
| XLogP | 4.68 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |