C28H30F2N4O2 — CID 129271590
N-[3-[(4aR,5S)-5-amino-5-methyl-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinolin-9-yl]-4-methylphenyl]-2-(1,1-difluoroethyl)pyridine-4-carboxamide (PubChem CID 129271590) has the molecular formula C28H30F2N4O2 and a molecular weight of 492.57 g/mol. Its IUPAC name is N-[3-[(4aR,5S)-5-amino-5-methyl-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinolin-9-yl]-4-methylphenyl]-2-(1,1-difluoroethyl)pyridine-4-carboxamide.
| Compound Name | N-[3-[(4aR,5S)-5-amino-5-methyl-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinolin-9-yl]-4-methylphenyl]-2-(1,1-difluoroethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 129271590 |
| Molecular Formula | C28H30F2N4O2 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | N-[3-[(4aR,5S)-5-amino-5-methyl-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinolin-9-yl]-4-methylphenyl]-2-(1,1-difluoroethyl)pyridine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccnc(C(C)(F)F)c2)cc1-c1ccc2c(c1)N1CCOC[C@H]1[C@@](C)(N)C2 |
| InChI | InChI=1S/C28H30F2N4O2/c1-17-4-7-21(33-26(35)19-8-9-32-24(13-19)28(3,29)30)14-22(17)18-5-6-20-15-27(2,31)25-16-36-11-10-34(25)23(20)12-18/h4-9,12-14,25H,10-11,15-16,31H2,1-3H3,(H,33,35)/t25-,27-/m0/s1 |
| InChIKey | SEIYIJYOPVDVHY-BDYUSTAISA-N |
| XLogP | 4.90 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |