C28H31F2N5O3 — CID 129271616
2-(1,1-difluoroethyl)-N-[3-(10-ethyl-9-oxo-5-oxa-2,10,12-triazabicyclo[9.4.0]pentadeca-1(11),12,14-trien-14-yl)-4-methylphenyl]pyridine-4-carboxamide (PubChem CID 129271616) has the molecular formula C28H31F2N5O3 and a molecular weight of 523.58 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-N-[3-(10-ethyl-9-oxo-5-oxa-2,10,12-triazabicyclo[9.4.0]pentadeca-1(11),12,14-trien-14-yl)-4-methylphenyl]pyridine-4-carboxamide.
| Compound Name | 2-(1,1-difluoroethyl)-N-[3-(10-ethyl-9-oxo-5-oxa-2,10,12-triazabicyclo[9.4.0]pentadeca-1(11),12,14-trien-14-yl)-4-methylphenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 129271616 |
| Molecular Formula | C28H31F2N5O3 |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 2-(1,1-difluoroethyl)-N-[3-(10-ethyl-9-oxo-5-oxa-2,10,12-triazabicyclo[9.4.0]pentadeca-1(11),12,14-trien-14-yl)-4-methylphenyl]pyridine-4-carboxamide |
| SMILES | CCN1C(=O)CCCOCCNc2cc(-c3cc(NC(=O)c4ccnc(C(C)(F)F)c4)ccc3C)cnc21 |
| InChI | InChI=1S/C28H31F2N5O3/c1-4-35-25(36)6-5-12-38-13-11-31-23-14-20(17-33-26(23)35)22-16-21(8-7-18(22)2)34-27(37)19-9-10-32-24(15-19)28(3,29)30/h7-10,14-17,31H,4-6,11-13H2,1-3H3,(H,34,37) |
| InChIKey | WDMLNBQXYQJUIY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |