C26H25F3N4O3 — CID 129271621
2-(1,1-difluoroethyl)-N-[3-(5-fluoro-6-hydroxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a][1,5]naphthyridin-9-yl)-4-methylphenyl]pyridine-4-carboxamide (PubChem CID 129271621) has the molecular formula C26H25F3N4O3 and a molecular weight of 498.51 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-N-[3-(5-fluoro-6-hydroxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a][1,5]naphthyridin-9-yl)-4-methylphenyl]pyridine-4-carboxamide.
| Compound Name | 2-(1,1-difluoroethyl)-N-[3-(5-fluoro-6-hydroxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a][1,5]naphthyridin-9-yl)-4-methylphenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 129271621 |
| Molecular Formula | C26H25F3N4O3 |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 2-(1,1-difluoroethyl)-N-[3-(5-fluoro-6-hydroxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a][1,5]naphthyridin-9-yl)-4-methylphenyl]pyridine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccnc(C(C)(F)F)c2)cc1-c1cnc2c(c1)N1CCOCC1C(F)C2O |
| InChI | InChI=1S/C26H25F3N4O3/c1-14-3-4-17(32-25(35)15-5-6-30-21(10-15)26(2,28)29)11-18(14)16-9-19-23(31-12-16)24(34)22(27)20-13-36-8-7-33(19)20/h3-6,9-12,20,22,24,34H,7-8,13H2,1-2H3,(H,32,35) |
| InChIKey | LCYRGFKBQPIHNA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |