C27H29FN4O3 — CID 129271622
2-(2-fluoropropan-2-yl)-N-[3-(6-hydroxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a][1,5]naphthyridin-9-yl)-4-methylphenyl]pyridine-4-carboxamide (PubChem CID 129271622) has the molecular formula C27H29FN4O3 and a molecular weight of 476.55 g/mol. Its IUPAC name is 2-(2-fluoropropan-2-yl)-N-[3-(6-hydroxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a][1,5]naphthyridin-9-yl)-4-methylphenyl]pyridine-4-carboxamide.
| Compound Name | 2-(2-fluoropropan-2-yl)-N-[3-(6-hydroxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a][1,5]naphthyridin-9-yl)-4-methylphenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 129271622 |
| Molecular Formula | C27H29FN4O3 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 2-(2-fluoropropan-2-yl)-N-[3-(6-hydroxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a][1,5]naphthyridin-9-yl)-4-methylphenyl]pyridine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccnc(C(C)(C)F)c2)cc1-c1cnc2c(c1)N1CCOCC1CC2O |
| InChI | InChI=1S/C27H29FN4O3/c1-16-4-5-19(31-26(34)17-6-7-29-24(11-17)27(2,3)28)12-21(16)18-10-22-25(30-14-18)23(33)13-20-15-35-9-8-32(20)22/h4-7,10-12,14,20,23,33H,8-9,13,15H2,1-3H3,(H,31,34) |
| InChIKey | CDQFKUMRMNPSOF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |