C27H27F3N4O4 — CID 129271633
N-[3-[5,5-bis(hydroxymethyl)-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridin-9-yl]-4-methylphenyl]-4-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 129271633) has the molecular formula C27H27F3N4O4 and a molecular weight of 528.53 g/mol. Its IUPAC name is N-[3-[5,5-bis(hydroxymethyl)-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridin-9-yl]-4-methylphenyl]-4-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[3-[5,5-bis(hydroxymethyl)-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridin-9-yl]-4-methylphenyl]-4-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 129271633 |
| Molecular Formula | C27H27F3N4O4 |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | N-[3-[5,5-bis(hydroxymethyl)-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a][1,5]naphthyridin-9-yl]-4-methylphenyl]-4-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(C(F)(F)F)ccn2)cc1-c1cnc2c(c1)N1CCOCC1C(CO)(CO)C2 |
| InChI | InChI=1S/C27H27F3N4O4/c1-16-2-3-19(33-25(37)21-9-18(4-5-31-21)27(28,29)30)10-20(16)17-8-23-22(32-12-17)11-26(14-35,15-36)24-13-38-7-6-34(23)24/h2-5,8-10,12,24,35-36H,6-7,11,13-15H2,1H3,(H,33,37) |
| InChIKey | XMWCSKLTUDOXBK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |