C28H28F3N5O3 — CID 129271642
N-[4-methyl-3-[6-(propanoylamino)-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a][1,5]naphthyridin-9-yl]phenyl]-2-(trifluoromethyl)pyridine-4-carboxamide (PubChem CID 129271642) has the molecular formula C28H28F3N5O3 and a molecular weight of 539.56 g/mol. Its IUPAC name is N-[4-methyl-3-[6-(propanoylamino)-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a][1,5]naphthyridin-9-yl]phenyl]-2-(trifluoromethyl)pyridine-4-carboxamide.
| Compound Name | N-[4-methyl-3-[6-(propanoylamino)-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a][1,5]naphthyridin-9-yl]phenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 129271642 |
| Molecular Formula | C28H28F3N5O3 |
| Molecular Weight | 539.56 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | N-[4-methyl-3-[6-(propanoylamino)-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a][1,5]naphthyridin-9-yl]phenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
| SMILES | CCC(=O)NC1CC2COCCN2c2cc(-c3cc(NC(=O)c4ccnc(C(F)(F)F)c4)ccc3C)cnc21 |
| InChI | InChI=1S/C28H28F3N5O3/c1-3-25(37)35-22-13-20-15-39-9-8-36(20)23-10-18(14-33-26(22)23)21-12-19(5-4-16(21)2)34-27(38)17-6-7-32-24(11-17)28(29,30)31/h4-7,10-12,14,20,22H,3,8-9,13,15H2,1-2H3,(H,34,38)(H,35,37) |
| InChIKey | INMHITYKJSAHMQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |