C28H28F3N3O3 — CID 129271692
N-[5-[(4aR,5R)-5-fluoro-5-(hydroxymethyl)-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinolin-9-yl]-6-methyl-3-pyridinyl]-3-(1,1-difluoroethyl)benzamide (PubChem CID 129271692) has the molecular formula C28H28F3N3O3 and a molecular weight of 511.54 g/mol. Its IUPAC name is N-[5-[(4aR,5R)-5-fluoro-5-(hydroxymethyl)-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinolin-9-yl]-6-methyl-3-pyridinyl]-3-(1,1-difluoroethyl)benzamide.
| Compound Name | N-[5-[(4aR,5R)-5-fluoro-5-(hydroxymethyl)-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinolin-9-yl]-6-methyl-3-pyridinyl]-3-(1,1-difluoroethyl)benzamide |
|---|---|
| PubChem CID | 129271692 |
| Molecular Formula | C28H28F3N3O3 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | N-[5-[(4aR,5R)-5-fluoro-5-(hydroxymethyl)-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinolin-9-yl]-6-methyl-3-pyridinyl]-3-(1,1-difluoroethyl)benzamide |
| SMILES | Cc1ncc(NC(=O)c2cccc(C(C)(F)F)c2)cc1-c1ccc2c(c1)N1CCOC[C@@H]1[C@@](F)(CO)C2 |
| InChI | InChI=1S/C28H28F3N3O3/c1-17-23(12-22(14-32-17)33-26(36)19-4-3-5-21(10-19)27(2,29)30)18-6-7-20-13-28(31,16-35)25-15-37-9-8-34(25)24(20)11-18/h3-7,10-12,14,25,35H,8-9,13,15-16H2,1-2H3,(H,33,36)/t25-,28+/m1/s1 |
| InChIKey | PLHYIHYYDPVVBK-NAKRPHOHSA-N |
| XLogP | 4.88 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |