C9H8F10N2 — CID 129271743
1-(1,1,1,2,3,4,4-heptafluorobut-3-en-2-yl)-4-(trifluoromethyl)piperazine (PubChem CID 129271743) has the molecular formula C9H8F10N2 and a molecular weight of 334.16 g/mol. Its IUPAC name is 1-(1,1,1,2,3,4,4-heptafluorobut-3-en-2-yl)-4-(trifluoromethyl)piperazine.
| Compound Name | 1-(1,1,1,2,3,4,4-heptafluorobut-3-en-2-yl)-4-(trifluoromethyl)piperazine |
|---|---|
| PubChem CID | 129271743 |
| Molecular Formula | C9H8F10N2 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 1-(1,1,1,2,3,4,4-heptafluorobut-3-en-2-yl)-4-(trifluoromethyl)piperazine |
| SMILES | FC(F)=C(F)C(F)(N1CCN(C(F)(F)F)CC1)C(F)(F)F |
| InChI | InChI=1S/C9H8F10N2/c10-5(6(11)12)7(13,8(14,15)16)20-1-3-21(4-2-20)9(17,18)19/h1-4H2 |
| InChIKey | QJHFNWLWEVEGAO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|