C11H8F13N — CID 129271751
1-(1,1,1,2,3,4,4-heptafluorobut-3-en-2-yl)-3,5-bis(trifluoromethyl)piperidine (PubChem CID 129271751) has the molecular formula C11H8F13N and a molecular weight of 401.17 g/mol. Its IUPAC name is 1-(1,1,1,2,3,4,4-heptafluorobut-3-en-2-yl)-3,5-bis(trifluoromethyl)piperidine.
| Compound Name | 1-(1,1,1,2,3,4,4-heptafluorobut-3-en-2-yl)-3,5-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 129271751 |
| Molecular Formula | C11H8F13N |
| Molecular Weight | 401.17 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 1-(1,1,1,2,3,4,4-heptafluorobut-3-en-2-yl)-3,5-bis(trifluoromethyl)piperidine |
| SMILES | FC(F)=C(F)C(F)(N1CC(C(F)(F)F)CC(C(F)(F)F)C1)C(F)(F)F |
| InChI | InChI=1S/C11H8F13N/c12-6(7(13)14)8(15,11(22,23)24)25-2-4(9(16,17)18)1-5(3-25)10(19,20)21/h4-5H,1-3H2 |
| InChIKey | BTUHUAKFEOZOIM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.17 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|