About 1-[(Z)-1,2-difluoroprop-1-enyl]-4-methylpiperazine
1-[(Z)-1,2-difluoroprop-1-enyl]-4-methylpiperazine (PubChem CID 129271764) has the molecular formula C8H14F2N2
and a molecular weight of 176.21 g/mol. Its IUPAC name is 1-[(Z)-1,2-difluoroprop-1-enyl]-4-methylpiperazine.
Molecular Properties
| Compound Name | 1-[(Z)-1,2-difluoroprop-1-enyl]-4-methylpiperazine |
| PubChem CID | 129271764 |
| Molecular Formula | C8H14F2N2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 1-[(Z)-1,2-difluoroprop-1-enyl]-4-methylpiperazine |
| SMILES | C/C(F)=C(/F)N1CCN(C)CC1 |
| InChI | InChI=1S/C8H14F2N2/c1-7(9)8(10)12-5-3-11(2)4-6-12/h3-6H2,1-2H3/b8-7+ |
| InChIKey | CYOAYAUDULADRH-BQYQJAHWSA-N |
| XLogP | 1.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-1,2-difluoroprop-1-enyl]-4-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-1,2-difluoroprop-1-enyl]-4-methylpiperazine?
The IUPAC name of 1-[(Z)-1,2-difluoroprop-1-enyl]-4-methylpiperazine (CID 129271764) is 1-[(Z)-1,2-difluoroprop-1-enyl]-4-methylpiperazine.
What is the SMILES notation for 1-[(Z)-1,2-difluoroprop-1-enyl]-4-methylpiperazine?
The canonical SMILES for 1-[(Z)-1,2-difluoroprop-1-enyl]-4-methylpiperazine is C/C(F)=C(/F)N1CCN(C)CC1.
What is the InChIKey of 1-[(Z)-1,2-difluoroprop-1-enyl]-4-methylpiperazine?
The InChIKey is CYOAYAUDULADRH-BQYQJAHWSA-N. The full InChI is InChI=1S/C8H14F2N2/c1-7(9)8(10)12-5-3-11(2)4-6-12/h3-6H2,1-2H3/b8-7+.
What are the key properties of 1-[(Z)-1,2-difluoroprop-1-enyl]-4-methylpiperazine?
1-[(Z)-1,2-difluoroprop-1-enyl]-4-methylpiperazine has a molecular weight of 176.21 g/mol, XLogP of 1.36, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-1,2-difluoroprop-1-enyl]-4-methylpiperazine is sourced from PubChem (CID 129271764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).