C26H26F2N4O3 — CID 129271908
2-(1,1-difluoroethyl)-N-[3-(6-hydroxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a][1,5]naphthyridin-9-yl)-4-methylphenyl]pyridine-4-carboxamide (PubChem CID 129271908) has the molecular formula C26H26F2N4O3 and a molecular weight of 480.52 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-N-[3-(6-hydroxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a][1,5]naphthyridin-9-yl)-4-methylphenyl]pyridine-4-carboxamide.
| Compound Name | 2-(1,1-difluoroethyl)-N-[3-(6-hydroxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a][1,5]naphthyridin-9-yl)-4-methylphenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 129271908 |
| Molecular Formula | C26H26F2N4O3 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 2-(1,1-difluoroethyl)-N-[3-(6-hydroxy-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a][1,5]naphthyridin-9-yl)-4-methylphenyl]pyridine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccnc(C(C)(F)F)c2)cc1-c1cnc2c(c1)N1CCOCC1CC2O |
| InChI | InChI=1S/C26H26F2N4O3/c1-15-3-4-18(31-25(34)16-5-6-29-23(10-16)26(2,27)28)11-20(15)17-9-21-24(30-13-17)22(33)12-19-14-35-8-7-32(19)21/h3-6,9-11,13,19,22,33H,7-8,12,14H2,1-2H3,(H,31,34) |
| InChIKey | WLZSAQBJFKJRMS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |