C27H26F4N4O2 — CID 129271926
N-[3-[(4aR,10bR)-6-ethyl-1,2,4,4a,5,10b-hexahydropyrano[3,4-c][1,8]naphthyridin-9-yl]-4-methylphenyl]-3-fluoro-2-(trifluoromethyl)pyridine-4-carboxamide (PubChem CID 129271926) has the molecular formula C27H26F4N4O2 and a molecular weight of 514.52 g/mol. Its IUPAC name is N-[3-[(4aR,10bR)-6-ethyl-1,2,4,4a,5,10b-hexahydropyrano[3,4-c][1,8]naphthyridin-9-yl]-4-methylphenyl]-3-fluoro-2-(trifluoromethyl)pyridine-4-carboxamide.
| Compound Name | N-[3-[(4aR,10bR)-6-ethyl-1,2,4,4a,5,10b-hexahydropyrano[3,4-c][1,8]naphthyridin-9-yl]-4-methylphenyl]-3-fluoro-2-(trifluoromethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 129271926 |
| Molecular Formula | C27H26F4N4O2 |
| Molecular Weight | 514.52 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | N-[3-[(4aR,10bR)-6-ethyl-1,2,4,4a,5,10b-hexahydropyrano[3,4-c][1,8]naphthyridin-9-yl]-4-methylphenyl]-3-fluoro-2-(trifluoromethyl)pyridine-4-carboxamide |
| SMILES | CCN1C[C@@H]2COCC[C@H]2c2cc(-c3cc(NC(=O)c4ccnc(C(F)(F)F)c4F)ccc3C)cnc21 |
| InChI | InChI=1S/C27H26F4N4O2/c1-3-35-13-17-14-37-9-7-19(17)22-10-16(12-33-25(22)35)21-11-18(5-4-15(21)2)34-26(36)20-6-8-32-24(23(20)28)27(29,30)31/h4-6,8,10-12,17,19H,3,7,9,13-14H2,1-2H3,(H,34,36)/t17-,19-/m1/s1 |
| InChIKey | YQVZIBOFZWQXJA-IEBWSBKVSA-N |
| XLogP | 5.82 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.52 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |