C28H30F2N4O2 — CID 129271928
N-[3-[(4aR,10bR)-6-ethyl-1,2,4,4a,5,10b-hexahydropyrano[3,4-c][1,8]naphthyridin-9-yl]-4-methylphenyl]-2-(1,1-difluoroethyl)pyridine-4-carboxamide (PubChem CID 129271928) has the molecular formula C28H30F2N4O2 and a molecular weight of 492.57 g/mol. Its IUPAC name is N-[3-[(4aR,10bR)-6-ethyl-1,2,4,4a,5,10b-hexahydropyrano[3,4-c][1,8]naphthyridin-9-yl]-4-methylphenyl]-2-(1,1-difluoroethyl)pyridine-4-carboxamide.
| Compound Name | N-[3-[(4aR,10bR)-6-ethyl-1,2,4,4a,5,10b-hexahydropyrano[3,4-c][1,8]naphthyridin-9-yl]-4-methylphenyl]-2-(1,1-difluoroethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 129271928 |
| Molecular Formula | C28H30F2N4O2 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | N-[3-[(4aR,10bR)-6-ethyl-1,2,4,4a,5,10b-hexahydropyrano[3,4-c][1,8]naphthyridin-9-yl]-4-methylphenyl]-2-(1,1-difluoroethyl)pyridine-4-carboxamide |
| SMILES | CCN1C[C@@H]2COCC[C@H]2c2cc(-c3cc(NC(=O)c4ccnc(C(C)(F)F)c4)ccc3C)cnc21 |
| InChI | InChI=1S/C28H30F2N4O2/c1-4-34-15-20-16-36-10-8-22(20)24-11-19(14-32-26(24)34)23-13-21(6-5-17(23)2)33-27(35)18-7-9-31-25(12-18)28(3,29)30/h5-7,9,11-14,20,22H,4,8,10,15-16H2,1-3H3,(H,33,35)/t20-,22-/m1/s1 |
| InChIKey | NKCGIBBFJDXHMX-IFMALSPDSA-N |
| XLogP | 5.78 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |