C30H32F2N4O3 — CID 129271960
9-[5-[[2-(1,1-difluoroethyl)pyridine-4-carbonyl]amino]-2-methylphenyl]-N-ethyl-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinoline-5-carboxamide (PubChem CID 129271960) has the molecular formula C30H32F2N4O3 and a molecular weight of 534.61 g/mol. Its IUPAC name is 9-[5-[[2-(1,1-difluoroethyl)pyridine-4-carbonyl]amino]-2-methylphenyl]-N-ethyl-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinoline-5-carboxamide.
| Compound Name | 9-[5-[[2-(1,1-difluoroethyl)pyridine-4-carbonyl]amino]-2-methylphenyl]-N-ethyl-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 129271960 |
| Molecular Formula | C30H32F2N4O3 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | 9-[5-[[2-(1,1-difluoroethyl)pyridine-4-carbonyl]amino]-2-methylphenyl]-N-ethyl-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinoline-5-carboxamide |
| SMILES | CCNC(=O)C1Cc2ccc(-c3cc(NC(=O)c4ccnc(C(C)(F)F)c4)ccc3C)cc2N2CCOCC12 |
| InChI | InChI=1S/C30H32F2N4O3/c1-4-33-29(38)24-13-20-7-6-19(14-25(20)36-11-12-39-17-26(24)36)23-16-22(8-5-18(23)2)35-28(37)21-9-10-34-27(15-21)30(3,31)32/h5-10,14-16,24,26H,4,11-13,17H2,1-3H3,(H,33,38)(H,35,37) |
| InChIKey | BOBBDAJHGZZIKP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |