C13H17BrN2O — CID 129272062
(4aR,10bR)-9-bromo-6-ethyl-1,2,4,4a,5,10b-hexahydropyrano[3,4-c][1,8]naphthyridine (PubChem CID 129272062) has the molecular formula C13H17BrN2O and a molecular weight of 297.20 g/mol. Its IUPAC name is (4aR,10bR)-9-bromo-6-ethyl-1,2,4,4a,5,10b-hexahydropyrano[3,4-c][1,8]naphthyridine.
| Compound Name | (4aR,10bR)-9-bromo-6-ethyl-1,2,4,4a,5,10b-hexahydropyrano[3,4-c][1,8]naphthyridine |
|---|---|
| PubChem CID | 129272062 |
| Molecular Formula | C13H17BrN2O |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | (4aR,10bR)-9-bromo-6-ethyl-1,2,4,4a,5,10b-hexahydropyrano[3,4-c][1,8]naphthyridine |
| SMILES | CCN1C[C@@H]2COCC[C@H]2c2cc(Br)cnc21 |
| InChI | InChI=1S/C13H17BrN2O/c1-2-16-7-9-8-17-4-3-11(9)12-5-10(14)6-15-13(12)16/h5-6,9,11H,2-4,7-8H2,1H3/t9-,11-/m1/s1 |
| InChIKey | UZKACKNWHHCOTC-MWLCHTKSSA-N |
| XLogP | 2.80 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |