About 1-bromo-3-ethoxybutane
1-bromo-3-ethoxybutane (PubChem CID 12927224) has the molecular formula C6H13BrO
and a molecular weight of 181.07 g/mol. Its IUPAC name is 1-bromo-3-ethoxybutane.
Molecular Properties
| Compound Name | 1-bromo-3-ethoxybutane |
| PubChem CID | 12927224 |
| Molecular Formula | C6H13BrO |
| Molecular Weight | 181.07 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | 1-bromo-3-ethoxybutane |
| SMILES | CCOC(C)CCBr |
| InChI | InChI=1S/C6H13BrO/c1-3-8-6(2)4-5-7/h6H,3-5H2,1-2H3 |
| InChIKey | QDANFWTUHFLZOL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.07 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3-ethoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-ethoxybutane?
The IUPAC name of 1-bromo-3-ethoxybutane (CID 12927224) is 1-bromo-3-ethoxybutane.
What is the SMILES notation for 1-bromo-3-ethoxybutane?
The canonical SMILES for 1-bromo-3-ethoxybutane is CCOC(C)CCBr.
What is the InChIKey of 1-bromo-3-ethoxybutane?
The InChIKey is QDANFWTUHFLZOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13BrO/c1-3-8-6(2)4-5-7/h6H,3-5H2,1-2H3.
What are the key properties of 1-bromo-3-ethoxybutane?
1-bromo-3-ethoxybutane has a molecular weight of 181.07 g/mol, XLogP of 2.20, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-ethoxybutane is sourced from PubChem (CID 12927224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).