C27H25F4N3O3 — CID 129272258
N-[3-[(4aR,5S)-5-fluoro-5-(hydroxymethyl)-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinolin-9-yl]-4-methylphenyl]-5-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 129272258) has the molecular formula C27H25F4N3O3 and a molecular weight of 515.51 g/mol. Its IUPAC name is N-[3-[(4aR,5S)-5-fluoro-5-(hydroxymethyl)-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinolin-9-yl]-4-methylphenyl]-5-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[3-[(4aR,5S)-5-fluoro-5-(hydroxymethyl)-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinolin-9-yl]-4-methylphenyl]-5-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 129272258 |
| Molecular Formula | C27H25F4N3O3 |
| Molecular Weight | 515.51 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | N-[3-[(4aR,5S)-5-fluoro-5-(hydroxymethyl)-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinolin-9-yl]-4-methylphenyl]-5-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cncc(C(F)(F)F)c2)cc1-c1ccc2c(c1)N1CCOC[C@@H]1[C@](F)(CO)C2 |
| InChI | InChI=1S/C27H25F4N3O3/c1-16-2-5-21(33-25(36)19-8-20(13-32-12-19)27(29,30)31)10-22(16)17-3-4-18-11-26(28,15-35)24-14-37-7-6-34(24)23(18)9-17/h2-5,8-10,12-13,24,35H,6-7,11,14-15H2,1H3,(H,33,36)/t24-,26-/m1/s1 |
| InChIKey | IEBWRPUYJDLECR-AOYPEHQESA-N |
| XLogP | 4.79 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |