About tert-butyl (3S)-3-methoxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate
tert-butyl (3S)-3-methoxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate (PubChem CID 129272367) has the molecular formula C29H33O4P
and a molecular weight of 476.55 g/mol. Its IUPAC name is tert-butyl (3S)-3-methoxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate.
Molecular Properties
| Compound Name | tert-butyl (3S)-3-methoxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate |
| PubChem CID | 129272367 |
| Molecular Formula | C29H33O4P |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | tert-butyl (3S)-3-methoxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate |
| SMILES | CO[C@@H](CC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H33O4P/c1-29(2,3)33-28(31)21-24(32-4)20-23(30)22-34(25-14-8-5-9-15-25,26-16-10-6-11-17-26)27-18-12-7-13-19-27/h5-19,22,24H,20-21H2,1-4H3/t24-/m0/s1 |
| InChIKey | ZKSDERHMBQMLRR-DEOSSOPVSA-N |
| XLogP | 4.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (3S)-3-methoxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3S)-3-methoxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate?
The IUPAC name of tert-butyl (3S)-3-methoxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate (CID 129272367) is tert-butyl (3S)-3-methoxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate.
What is the SMILES notation for tert-butyl (3S)-3-methoxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate?
The canonical SMILES for tert-butyl (3S)-3-methoxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate is CO[C@@H](CC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1)CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (3S)-3-methoxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate?
The InChIKey is ZKSDERHMBQMLRR-DEOSSOPVSA-N. The full InChI is InChI=1S/C29H33O4P/c1-29(2,3)33-28(31)21-24(32-4)20-23(30)22-34(25-14-8-5-9-15-25,26-16-10-6-11-17-26)27-18-12-7-13-19-27/h5-19,22,24H,20-21H2,1-4H3/t24-/m0/s1.
What are the key properties of tert-butyl (3S)-3-methoxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate?
tert-butyl (3S)-3-methoxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate has a molecular weight of 476.55 g/mol, XLogP of 4.49, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3S)-3-methoxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate is sourced from PubChem (CID 129272367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).