About N-methyl-1-[(4Z,5E)-2-methyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-3-yl]ethanamine
N-methyl-1-[(4Z,5E)-2-methyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-3-yl]ethanamine (PubChem CID 129272760) has the molecular formula C14H20N2
and a molecular weight of 216.33 g/mol. Its IUPAC name is N-methyl-1-[(4Z,5E)-2-methyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-3-yl]ethanamine.
Molecular Properties
| Compound Name | N-methyl-1-[(4Z,5E)-2-methyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-3-yl]ethanamine |
| PubChem CID | 129272760 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | N-methyl-1-[(4Z,5E)-2-methyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-3-yl]ethanamine |
| SMILES | C=C/C=c1/c(C(C)NC)c(C)[nH]/c1=C/C=C |
| InChI | InChI=1S/C14H20N2/c1-6-8-12-13(9-7-2)16-11(4)14(12)10(3)15-5/h6-10,15-16H,1-2H2,3-5H3/b12-8+,13-9+ |
| InChIKey | FTCWDFGRTWVLLM-QHKWOANTSA-N |
| XLogP | 1.54 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methyl-1-[(4Z,5E)-2-methyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-3-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[(4Z,5E)-2-methyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-3-yl]ethanamine?
The IUPAC name of N-methyl-1-[(4Z,5E)-2-methyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-3-yl]ethanamine (CID 129272760) is N-methyl-1-[(4Z,5E)-2-methyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-3-yl]ethanamine.
What is the SMILES notation for N-methyl-1-[(4Z,5E)-2-methyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-3-yl]ethanamine?
The canonical SMILES for N-methyl-1-[(4Z,5E)-2-methyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-3-yl]ethanamine is C=C/C=c1/c(C(C)NC)c(C)[nH]/c1=C/C=C.
What is the InChIKey of N-methyl-1-[(4Z,5E)-2-methyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-3-yl]ethanamine?
The InChIKey is FTCWDFGRTWVLLM-QHKWOANTSA-N. The full InChI is InChI=1S/C14H20N2/c1-6-8-12-13(9-7-2)16-11(4)14(12)10(3)15-5/h6-10,15-16H,1-2H2,3-5H3/b12-8+,13-9+.
What are the key properties of N-methyl-1-[(4Z,5E)-2-methyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-3-yl]ethanamine?
N-methyl-1-[(4Z,5E)-2-methyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-3-yl]ethanamine has a molecular weight of 216.33 g/mol, XLogP of 1.54, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[(4Z,5E)-2-methyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-3-yl]ethanamine is sourced from PubChem (CID 129272760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).