C23H22N6O3S — CID 129272989
N-[4-[6-[(Z)-3-amino-2-sulfanylprop-2-enoyl]-3-anilino-4-oxo-5,7-dihydro-1H-pyrrolo[2,3-c]pyridin-2-yl]-2-pyridinyl]acetamide (PubChem CID 129272989) has the molecular formula C23H22N6O3S and a molecular weight of 462.54 g/mol. Its IUPAC name is N-[4-[6-[(Z)-3-amino-2-sulfanylprop-2-enoyl]-3-anilino-4-oxo-5,7-dihydro-1H-pyrrolo[2,3-c]pyridin-2-yl]-2-pyridinyl]acetamide.
| Compound Name | N-[4-[6-[(Z)-3-amino-2-sulfanylprop-2-enoyl]-3-anilino-4-oxo-5,7-dihydro-1H-pyrrolo[2,3-c]pyridin-2-yl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 129272989 |
| Molecular Formula | C23H22N6O3S |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | N-[4-[6-[(Z)-3-amino-2-sulfanylprop-2-enoyl]-3-anilino-4-oxo-5,7-dihydro-1H-pyrrolo[2,3-c]pyridin-2-yl]-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(-c2[nH]c3c(c2Nc2ccccc2)C(=O)CN(C(=O)/C(S)=C/N)C3)ccn1 |
| InChI | InChI=1S/C23H22N6O3S/c1-13(30)26-19-9-14(7-8-25-19)21-22(27-15-5-3-2-4-6-15)20-16(28-21)11-29(12-17(20)31)23(32)18(33)10-24/h2-10,27-28,33H,11-12,24H2,1H3,(H,25,26,30)/b18-10- |
| InChIKey | UDSZPAPHGATYQZ-ZDLGFXPLSA-N |
| XLogP | 3.03 |
| TPSA | 133.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|