About 2-methylperoxyacetamide
2-methylperoxyacetamide (PubChem CID 129273207) has the molecular formula C3H7NO3
and a molecular weight of 105.09 g/mol. Its IUPAC name is 2-methylperoxyacetamide.
Molecular Properties
| Compound Name | 2-methylperoxyacetamide |
| PubChem CID | 129273207 |
| Molecular Formula | C3H7NO3 |
| Molecular Weight | 105.09 g/mol |
| Exact Mass | 105.04 |
| IUPAC Name | 2-methylperoxyacetamide |
| SMILES | COOCC(N)=O |
| InChI | InChI=1S/C3H7NO3/c1-6-7-2-3(4)5/h2H2,1H3,(H2,4,5) |
| InChIKey | WROZZKKJWQOBDQ-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.09 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylperoxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylperoxyacetamide?
The IUPAC name of 2-methylperoxyacetamide (CID 129273207) is 2-methylperoxyacetamide.
What is the SMILES notation for 2-methylperoxyacetamide?
The canonical SMILES for 2-methylperoxyacetamide is COOCC(N)=O.
What is the InChIKey of 2-methylperoxyacetamide?
The InChIKey is WROZZKKJWQOBDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO3/c1-6-7-2-3(4)5/h2H2,1H3,(H2,4,5).
What are the key properties of 2-methylperoxyacetamide?
2-methylperoxyacetamide has a molecular weight of 105.09 g/mol, XLogP of -0.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylperoxyacetamide is sourced from PubChem (CID 129273207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).