C18H23BrN4O2 — CID 129273214
tert-butyl (3R)-3-[[(7-bromoquinazolin-2-yl)amino]methyl]pyrrolidine-1-carboxylate (PubChem CID 129273214) has the molecular formula C18H23BrN4O2 and a molecular weight of 407.31 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[(7-bromoquinazolin-2-yl)amino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[(7-bromoquinazolin-2-yl)amino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 129273214 |
| Molecular Formula | C18H23BrN4O2 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | tert-butyl (3R)-3-[[(7-bromoquinazolin-2-yl)amino]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](CNc2ncc3ccc(Br)cc3n2)C1 |
| InChI | InChI=1S/C18H23BrN4O2/c1-18(2,3)25-17(24)23-7-6-12(11-23)9-20-16-21-10-13-4-5-14(19)8-15(13)22-16/h4-5,8,10,12H,6-7,9,11H2,1-3H3,(H,20,21,22)/t12-/m1/s1 |
| InChIKey | FSHCUNOWANJDOH-GFCCVEGCSA-N |
| XLogP | 4.06 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |