C8H8FNO — CID 129273747
5-fluoro-1,3,3a,4-tetrahydroindol-2-one (PubChem CID 129273747) has the molecular formula C8H8FNO and a molecular weight of 153.16 g/mol. Its IUPAC name is 5-fluoro-1,3,3a,4-tetrahydroindol-2-one.
| Compound Name | 5-fluoro-1,3,3a,4-tetrahydroindol-2-one |
|---|---|
| PubChem CID | 129273747 |
| Molecular Formula | C8H8FNO |
| Molecular Weight | 153.16 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 5-fluoro-1,3,3a,4-tetrahydroindol-2-one |
| SMILES | O=C1CC2CC(F)=CC=C2N1 |
| InChI | InChI=1S/C8H8FNO/c9-6-1-2-7-5(3-6)4-8(11)10-7/h1-2,5H,3-4H2,(H,10,11) |
| InChIKey | RGDILXDFBKXRIS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.16 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |