About S-propan-2-yl 5-(butan-2-ylcarbamoyl)-2-methylheptanethioate
S-propan-2-yl 5-(butan-2-ylcarbamoyl)-2-methylheptanethioate (PubChem CID 129274024) has the molecular formula C16H31NO2S
and a molecular weight of 301.50 g/mol. Its IUPAC name is S-propan-2-yl 5-(butan-2-ylcarbamoyl)-2-methylheptanethioate.
Molecular Properties
| Compound Name | S-propan-2-yl 5-(butan-2-ylcarbamoyl)-2-methylheptanethioate |
| PubChem CID | 129274024 |
| Molecular Formula | C16H31NO2S |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.21 |
| IUPAC Name | S-propan-2-yl 5-(butan-2-ylcarbamoyl)-2-methylheptanethioate |
| SMILES | CCC(C)NC(=O)C(CC)CCC(C)C(=O)SC(C)C |
| InChI | InChI=1S/C16H31NO2S/c1-7-13(6)17-15(18)14(8-2)10-9-12(5)16(19)20-11(3)4/h11-14H,7-10H2,1-6H3,(H,17,18) |
| InChIKey | UBFGNKNSOYLXNQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-propan-2-yl 5-(butan-2-ylcarbamoyl)-2-methylheptanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-propan-2-yl 5-(butan-2-ylcarbamoyl)-2-methylheptanethioate?
The IUPAC name of S-propan-2-yl 5-(butan-2-ylcarbamoyl)-2-methylheptanethioate (CID 129274024) is S-propan-2-yl 5-(butan-2-ylcarbamoyl)-2-methylheptanethioate.
What is the SMILES notation for S-propan-2-yl 5-(butan-2-ylcarbamoyl)-2-methylheptanethioate?
The canonical SMILES for S-propan-2-yl 5-(butan-2-ylcarbamoyl)-2-methylheptanethioate is CCC(C)NC(=O)C(CC)CCC(C)C(=O)SC(C)C.
What is the InChIKey of S-propan-2-yl 5-(butan-2-ylcarbamoyl)-2-methylheptanethioate?
The InChIKey is UBFGNKNSOYLXNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO2S/c1-7-13(6)17-15(18)14(8-2)10-9-12(5)16(19)20-11(3)4/h11-14H,7-10H2,1-6H3,(H,17,18).
What are the key properties of S-propan-2-yl 5-(butan-2-ylcarbamoyl)-2-methylheptanethioate?
S-propan-2-yl 5-(butan-2-ylcarbamoyl)-2-methylheptanethioate has a molecular weight of 301.50 g/mol, XLogP of 4.01, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-propan-2-yl 5-(butan-2-ylcarbamoyl)-2-methylheptanethioate is sourced from PubChem (CID 129274024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).