About (4Z)-10,10-dichlorobicyclo[6.2.0]dec-4-en-9-ol
(4Z)-10,10-dichlorobicyclo[6.2.0]dec-4-en-9-ol (PubChem CID 129274187) has the molecular formula C10H14Cl2O
and a molecular weight of 221.13 g/mol. Its IUPAC name is (4Z)-10,10-dichlorobicyclo[6.2.0]dec-4-en-9-ol.
Molecular Properties
| Compound Name | (4Z)-10,10-dichlorobicyclo[6.2.0]dec-4-en-9-ol |
| PubChem CID | 129274187 |
| Molecular Formula | C10H14Cl2O |
| Molecular Weight | 221.13 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | (4Z)-10,10-dichlorobicyclo[6.2.0]dec-4-en-9-ol |
| SMILES | OC1C2CC/C=C\CCC2C1(Cl)Cl |
| InChI | InChI=1S/C10H14Cl2O/c11-10(12)8-6-4-2-1-3-5-7(8)9(10)13/h1-2,7-9,13H,3-6H2/b2-1- |
| InChIKey | PBTHGJMDAAWBSB-UPHRSURJSA-N |
| XLogP | 2.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.13 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-10,10-dichlorobicyclo[6.2.0]dec-4-en-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-10,10-dichlorobicyclo[6.2.0]dec-4-en-9-ol?
The IUPAC name of (4Z)-10,10-dichlorobicyclo[6.2.0]dec-4-en-9-ol (CID 129274187) is (4Z)-10,10-dichlorobicyclo[6.2.0]dec-4-en-9-ol.
What is the SMILES notation for (4Z)-10,10-dichlorobicyclo[6.2.0]dec-4-en-9-ol?
The canonical SMILES for (4Z)-10,10-dichlorobicyclo[6.2.0]dec-4-en-9-ol is OC1C2CC/C=C\CCC2C1(Cl)Cl.
What is the InChIKey of (4Z)-10,10-dichlorobicyclo[6.2.0]dec-4-en-9-ol?
The InChIKey is PBTHGJMDAAWBSB-UPHRSURJSA-N. The full InChI is InChI=1S/C10H14Cl2O/c11-10(12)8-6-4-2-1-3-5-7(8)9(10)13/h1-2,7-9,13H,3-6H2/b2-1-.
What are the key properties of (4Z)-10,10-dichlorobicyclo[6.2.0]dec-4-en-9-ol?
(4Z)-10,10-dichlorobicyclo[6.2.0]dec-4-en-9-ol has a molecular weight of 221.13 g/mol, XLogP of 2.90, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-10,10-dichlorobicyclo[6.2.0]dec-4-en-9-ol is sourced from PubChem (CID 129274187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).