C26H2Cl4F10N2O4 — CID 129274385
2,3,9,10-tetrachloro-14-hydroxy-6,13-bis(2,3,4,5,6-pentafluorophenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12-trione (PubChem CID 129274385) has the molecular formula C26H2Cl4F10N2O4 and a molecular weight of 738.10 g/mol. Its IUPAC name is 2,3,9,10-tetrachloro-14-hydroxy-6,13-bis(2,3,4,5,6-pentafluorophenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12-trione.
| Compound Name | 2,3,9,10-tetrachloro-14-hydroxy-6,13-bis(2,3,4,5,6-pentafluorophenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12-trione |
|---|---|
| PubChem CID | 129274385 |
| Molecular Formula | C26H2Cl4F10N2O4 |
| Molecular Weight | 738.10 g/mol |
| Exact Mass | 735.86 |
| IUPAC Name | 2,3,9,10-tetrachloro-14-hydroxy-6,13-bis(2,3,4,5,6-pentafluorophenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12-trione |
| SMILES | O=C1c2c(Cl)c(Cl)c3c4c(c(Cl)c(Cl)c(c24)C(=O)N1c1c(F)c(F)c(F)c(F)c1F)C(O)N(c1c(F)c(F)c(F)c(F)c1F)C3=O |
| InChI | InChI=1S/C26H2Cl4F10N2O4/c27-7-3-1-2-5(9(7)29)25(45)42(22-19(39)15(35)12(32)16(36)20(22)40)26(46)6(2)10(30)8(28)4(1)24(44)41(23(3)43)21-17(37)13(33)11(31)14(34)18(21)38/h23,43H |
| InChIKey | UGZZRMZXRGNPEK-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.10 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|