C14H18O7 — CID 129274451
(3'R,4R,4'S,5'S,6'R)-6'-(hydroxymethyl)-6-methylspiro[1,3-benzodioxine-4,2'-oxane]-3',4',5'-triol (PubChem CID 129274451) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is (3'R,4R,4'S,5'S,6'R)-6'-(hydroxymethyl)-6-methylspiro[1,3-benzodioxine-4,2'-oxane]-3',4',5'-triol.
| Compound Name | (3'R,4R,4'S,5'S,6'R)-6'-(hydroxymethyl)-6-methylspiro[1,3-benzodioxine-4,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 129274451 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (3'R,4R,4'S,5'S,6'R)-6'-(hydroxymethyl)-6-methylspiro[1,3-benzodioxine-4,2'-oxane]-3',4',5'-triol |
| SMILES | Cc1ccc2c(c1)[C@]1(OCO2)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H18O7/c1-7-2-3-9-8(4-7)14(20-6-19-9)13(18)12(17)11(16)10(5-15)21-14/h2-4,10-13,15-18H,5-6H2,1H3/t10-,11-,12+,13-,14+/m1/s1 |
| InChIKey | VASPUDQTGGJJOF-RGDJUOJXSA-N |
| XLogP | -1.01 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |