C10H30N4P4 — CID 129274493
N,N'-bis(phosphanyl)-N,N'-bis[3-(phosphanylamino)propyl]butane-1,4-diamine (PubChem CID 129274493) has the molecular formula C10H30N4P4 and a molecular weight of 330.27 g/mol. Its IUPAC name is N,N'-bis(phosphanyl)-N,N'-bis[3-(phosphanylamino)propyl]butane-1,4-diamine.
| Compound Name | N,N'-bis(phosphanyl)-N,N'-bis[3-(phosphanylamino)propyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 129274493 |
| Molecular Formula | C10H30N4P4 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | N,N'-bis(phosphanyl)-N,N'-bis[3-(phosphanylamino)propyl]butane-1,4-diamine |
| SMILES | PNCCCN(P)CCCCN(P)CCCNP |
| InChI | InChI=1S/C10H30N4P4/c15-11-5-3-9-13(17)7-1-2-8-14(18)10-4-6-12-16/h11-12H,1-10,15-18H2 |
| InChIKey | AKWRVDXXIFUVNE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|