About 2,3,3-triamino-N'-methylprop-2-enimidamide
2,3,3-triamino-N'-methylprop-2-enimidamide (PubChem CID 129274517) has the molecular formula C4H11N5
and a molecular weight of 129.17 g/mol. Its IUPAC name is 2,3,3-triamino-N'-methylprop-2-enimidamide.
Molecular Properties
| Compound Name | 2,3,3-triamino-N'-methylprop-2-enimidamide |
| PubChem CID | 129274517 |
| Molecular Formula | C4H11N5 |
| Molecular Weight | 129.17 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | 2,3,3-triamino-N'-methylprop-2-enimidamide |
| SMILES | C/N=C(\N)C(N)=C(N)N |
| InChI | InChI=1S/C4H11N5/c1-9-4(8)2(5)3(6)7/h5-7H2,1H3,(H2,8,9) |
| InChIKey | HWOSRNOBESRDAF-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.17 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3,3-triamino-N'-methylprop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,3-triamino-N'-methylprop-2-enimidamide?
The IUPAC name of 2,3,3-triamino-N'-methylprop-2-enimidamide (CID 129274517) is 2,3,3-triamino-N'-methylprop-2-enimidamide.
What is the SMILES notation for 2,3,3-triamino-N'-methylprop-2-enimidamide?
The canonical SMILES for 2,3,3-triamino-N'-methylprop-2-enimidamide is C/N=C(\N)C(N)=C(N)N.
What is the InChIKey of 2,3,3-triamino-N'-methylprop-2-enimidamide?
The InChIKey is HWOSRNOBESRDAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N5/c1-9-4(8)2(5)3(6)7/h5-7H2,1H3,(H2,8,9).
What are the key properties of 2,3,3-triamino-N'-methylprop-2-enimidamide?
2,3,3-triamino-N'-methylprop-2-enimidamide has a molecular weight of 129.17 g/mol, XLogP of -1.98, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,3-triamino-N'-methylprop-2-enimidamide is sourced from PubChem (CID 129274517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).