C18H27F3N2O2 — CID 129274654
N-ethyl-N'-[5-methoxy-2-methyl-4-(1,1,1-trifluoro-2-hydroxy-4-methylpentan-2-yl)phenyl]-N-methylmethanimidamide (PubChem CID 129274654) has the molecular formula C18H27F3N2O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is N-ethyl-N'-[5-methoxy-2-methyl-4-(1,1,1-trifluoro-2-hydroxy-4-methylpentan-2-yl)phenyl]-N-methylmethanimidamide.
| Compound Name | N-ethyl-N'-[5-methoxy-2-methyl-4-(1,1,1-trifluoro-2-hydroxy-4-methylpentan-2-yl)phenyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 129274654 |
| Molecular Formula | C18H27F3N2O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-ethyl-N'-[5-methoxy-2-methyl-4-(1,1,1-trifluoro-2-hydroxy-4-methylpentan-2-yl)phenyl]-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(OC)c(C(O)(CC(C)C)C(F)(F)F)cc1C |
| InChI | InChI=1S/C18H27F3N2O2/c1-7-23(5)11-22-15-9-16(25-6)14(8-13(15)4)17(24,10-12(2)3)18(19,20)21/h8-9,11-12,24H,7,10H2,1-6H3/b22-11+ |
| InChIKey | VEXFYFIMEXWMIZ-SSDVNMTOSA-N |
| XLogP | 4.41 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|