C18H25F3N2 — CID 129274657
N'-[4-(2-cyclopropyl-1,1,1-trifluoropropan-2-yl)-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 129274657) has the molecular formula C18H25F3N2 and a molecular weight of 326.41 g/mol. Its IUPAC name is N'-[4-(2-cyclopropyl-1,1,1-trifluoropropan-2-yl)-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-(2-cyclopropyl-1,1,1-trifluoropropan-2-yl)-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 129274657 |
| Molecular Formula | C18H25F3N2 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | N'-[4-(2-cyclopropyl-1,1,1-trifluoropropan-2-yl)-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(C(C)(C2CC2)C(F)(F)F)cc1C |
| InChI | InChI=1S/C18H25F3N2/c1-6-23(5)11-22-16-10-12(2)15(9-13(16)3)17(4,14-7-8-14)18(19,20)21/h9-11,14H,6-8H2,1-5H3/b22-11+ |
| InChIKey | VRRUKOFEMVPIQR-SSDVNMTOSA-N |
| XLogP | 5.14 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|