C19H27F3N2O2 — CID 129274658
N'-[4-(1-cyclopentyl-2,2,2-trifluoro-1-hydroxyethyl)-5-methoxy-2-methylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 129274658) has the molecular formula C19H27F3N2O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is N'-[4-(1-cyclopentyl-2,2,2-trifluoro-1-hydroxyethyl)-5-methoxy-2-methylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-(1-cyclopentyl-2,2,2-trifluoro-1-hydroxyethyl)-5-methoxy-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 129274658 |
| Molecular Formula | C19H27F3N2O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N'-[4-(1-cyclopentyl-2,2,2-trifluoro-1-hydroxyethyl)-5-methoxy-2-methylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(OC)c(C(O)(C2CCCC2)C(F)(F)F)cc1C |
| InChI | InChI=1S/C19H27F3N2O2/c1-5-24(3)12-23-16-11-17(26-4)15(10-13(16)2)18(25,19(20,21)22)14-8-6-7-9-14/h10-12,14,25H,5-9H2,1-4H3/b23-12+ |
| InChIKey | ODUHLYQPUTXNQD-FSJBWODESA-N |
| XLogP | 4.56 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|