C17H23F3N2O2 — CID 129274659
N-ethyl-N'-[5-methoxy-2-methyl-4-(1,1,1-trifluoro-2-hydroxypent-4-en-2-yl)phenyl]-N-methylmethanimidamide (PubChem CID 129274659) has the molecular formula C17H23F3N2O2 and a molecular weight of 344.38 g/mol. Its IUPAC name is N-ethyl-N'-[5-methoxy-2-methyl-4-(1,1,1-trifluoro-2-hydroxypent-4-en-2-yl)phenyl]-N-methylmethanimidamide.
| Compound Name | N-ethyl-N'-[5-methoxy-2-methyl-4-(1,1,1-trifluoro-2-hydroxypent-4-en-2-yl)phenyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 129274659 |
| Molecular Formula | C17H23F3N2O2 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-ethyl-N'-[5-methoxy-2-methyl-4-(1,1,1-trifluoro-2-hydroxypent-4-en-2-yl)phenyl]-N-methylmethanimidamide |
| SMILES | C=CCC(O)(c1cc(C)c(/N=C/N(C)CC)cc1OC)C(F)(F)F |
| InChI | InChI=1S/C17H23F3N2O2/c1-6-8-16(23,17(18,19)20)13-9-12(3)14(10-15(13)24-5)21-11-22(4)7-2/h6,9-11,23H,1,7-8H2,2-5H3/b21-11+ |
| InChIKey | AUGIQLBZYAMYRW-SRZZPIQSSA-N |
| XLogP | 3.94 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|