C19H21F3N2O2 — CID 129274660
N'-[5-methoxy-2-methyl-4-(2,2,2-trifluoro-1-hydroxy-1-phenylethyl)phenyl]-N,N-dimethylmethanimidamide (PubChem CID 129274660) has the molecular formula C19H21F3N2O2 and a molecular weight of 366.38 g/mol. Its IUPAC name is N'-[5-methoxy-2-methyl-4-(2,2,2-trifluoro-1-hydroxy-1-phenylethyl)phenyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[5-methoxy-2-methyl-4-(2,2,2-trifluoro-1-hydroxy-1-phenylethyl)phenyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 129274660 |
| Molecular Formula | C19H21F3N2O2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | N'-[5-methoxy-2-methyl-4-(2,2,2-trifluoro-1-hydroxy-1-phenylethyl)phenyl]-N,N-dimethylmethanimidamide |
| SMILES | COc1cc(/N=C/N(C)C)c(C)cc1C(O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C19H21F3N2O2/c1-13-10-15(17(26-4)11-16(13)23-12-24(2)3)18(25,19(20,21)22)14-8-6-5-7-9-14/h5-12,25H,1-4H3/b23-12+ |
| InChIKey | GJWYWNOMDWOLCN-FSJBWODESA-N |
| XLogP | 4.02 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|