C24H29F4NO — CID 129274700
1-[2-ethyl-5-methyl-4-(2-methylhexylideneamino)phenyl]-2,2,2-trifluoro-1-(3-fluorophenyl)ethanol (PubChem CID 129274700) has the molecular formula C24H29F4NO and a molecular weight of 423.49 g/mol. Its IUPAC name is 1-[2-ethyl-5-methyl-4-(2-methylhexylideneamino)phenyl]-2,2,2-trifluoro-1-(3-fluorophenyl)ethanol.
| Compound Name | 1-[2-ethyl-5-methyl-4-(2-methylhexylideneamino)phenyl]-2,2,2-trifluoro-1-(3-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 129274700 |
| Molecular Formula | C24H29F4NO |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 1-[2-ethyl-5-methyl-4-(2-methylhexylideneamino)phenyl]-2,2,2-trifluoro-1-(3-fluorophenyl)ethanol |
| SMILES | CCCCC(C)/C=N/c1cc(CC)c(C(O)(c2cccc(F)c2)C(F)(F)F)cc1C |
| InChI | InChI=1S/C24H29F4NO/c1-5-7-9-16(3)15-29-22-13-18(6-2)21(12-17(22)4)23(30,24(26,27)28)19-10-8-11-20(25)14-19/h8,10-16,30H,5-7,9H2,1-4H3/b29-15+ |
| InChIKey | LNUSSQIGAHFODQ-WKULSOCRSA-N |
| XLogP | 7.02 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|