C41H57FO7S — CID 129274801
(3'R,4R,4'S,5'R,6'R)-3',4',5'-tributoxy-6'-(butoxymethyl)-6-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-7-methylspiro[1,3-benzodioxine-4,2'-oxane] (PubChem CID 129274801) has the molecular formula C41H57FO7S and a molecular weight of 712.97 g/mol. Its IUPAC name is (3'R,4R,4'S,5'R,6'R)-3',4',5'-tributoxy-6'-(butoxymethyl)-6-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-7-methylspiro[1,3-benzodioxine-4,2'-oxane].
| Compound Name | (3'R,4R,4'S,5'R,6'R)-3',4',5'-tributoxy-6'-(butoxymethyl)-6-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-7-methylspiro[1,3-benzodioxine-4,2'-oxane] |
|---|---|
| PubChem CID | 129274801 |
| Molecular Formula | C41H57FO7S |
| Molecular Weight | 712.97 g/mol |
| Exact Mass | 712.38 |
| IUPAC Name | (3'R,4R,4'S,5'R,6'R)-3',4',5'-tributoxy-6'-(butoxymethyl)-6-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-7-methylspiro[1,3-benzodioxine-4,2'-oxane] |
| SMILES | CCCCOC[C@H]1O[C@]2(OCOc3cc(C)c(Cc4ccc(-c5ccc(F)cc5)s4)cc32)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C41H57FO7S/c1-6-10-20-43-27-36-38(44-21-11-7-2)39(45-22-12-8-3)40(46-23-13-9-4)41(49-36)34-26-31(29(5)24-35(34)47-28-48-41)25-33-18-19-37(50-33)30-14-16-32(42)17-15-30/h14-19,24,26,36,38-40H,6-13,20-23,25,27-28H2,1-5H3/t36-,38-,39+,40-,41+/m1/s1 |
| InChIKey | GDYBLKYMDGRRAY-REIISCNKSA-N |
| XLogP | 9.74 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.97 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|