C13H23N2P — CID 129274909
(1-methyl-1,4,5,6,7,8,9,10,11,12-decahydrocyclodeca[d]pyridazin-4-yl)phosphane (PubChem CID 129274909) has the molecular formula C13H23N2P and a molecular weight of 238.31 g/mol. Its IUPAC name is (1-methyl-1,4,5,6,7,8,9,10,11,12-decahydrocyclodeca[d]pyridazin-4-yl)phosphane.
| Compound Name | (1-methyl-1,4,5,6,7,8,9,10,11,12-decahydrocyclodeca[d]pyridazin-4-yl)phosphane |
|---|---|
| PubChem CID | 129274909 |
| Molecular Formula | C13H23N2P |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (1-methyl-1,4,5,6,7,8,9,10,11,12-decahydrocyclodeca[d]pyridazin-4-yl)phosphane |
| SMILES | CC1N=NC(P)C2=C1CCCCCCCC2 |
| InChI | InChI=1S/C13H23N2P/c1-10-11-8-6-4-2-3-5-7-9-12(11)13(16)15-14-10/h10,13H,2-9,16H2,1H3 |
| InChIKey | VFHFUYVQECRJHR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|