C26H41NO2 — CID 129274966
(Z)-N-ethyl-7-[(1R)-2-[(1E,3S,6Z,7Z)-6-ethylidene-3-hydroxydeca-1,7,9-trienyl]cyclopentyl]hept-5-enamide (PubChem CID 129274966) has the molecular formula C26H41NO2 and a molecular weight of 399.62 g/mol. Its IUPAC name is (Z)-N-ethyl-7-[(1R)-2-[(1E,3S,6Z,7Z)-6-ethylidene-3-hydroxydeca-1,7,9-trienyl]cyclopentyl]hept-5-enamide.
| Compound Name | (Z)-N-ethyl-7-[(1R)-2-[(1E,3S,6Z,7Z)-6-ethylidene-3-hydroxydeca-1,7,9-trienyl]cyclopentyl]hept-5-enamide |
|---|---|
| PubChem CID | 129274966 |
| Molecular Formula | C26H41NO2 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.31 |
| IUPAC Name | (Z)-N-ethyl-7-[(1R)-2-[(1E,3S,6Z,7Z)-6-ethylidene-3-hydroxydeca-1,7,9-trienyl]cyclopentyl]hept-5-enamide |
| SMILES | C=C/C=C\C(=C/C)CC[C@H](O)/C=C/C1CCC[C@@H]1C/C=C\CCCC(=O)NCC |
| InChI | InChI=1S/C26H41NO2/c1-4-7-13-22(5-2)18-20-25(28)21-19-24-16-12-15-23(24)14-10-8-9-11-17-26(29)27-6-3/h4-5,7-8,10,13,19,21,23-25,28H,1,6,9,11-12,14-18,20H2,2-3H3,(H,27,29)/b10-8-,13-7-,21-19+,22-5+/t23-,24?,25-/m0/s1 |
| InChIKey | XFHVLVYVMATTMH-TVXAFJRCSA-N |
| XLogP | 6.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|