C13H15N7O3S — CID 129275061
N-(2-azidoethyl)-9-oxo-10-prop-2-enoxy-3-thia-5,8,10-triazatricyclo[6.2.1.02,6]undeca-2(6),4-diene-7-carboxamide (PubChem CID 129275061) has the molecular formula C13H15N7O3S and a molecular weight of 349.38 g/mol. Its IUPAC name is N-(2-azidoethyl)-9-oxo-10-prop-2-enoxy-3-thia-5,8,10-triazatricyclo[6.2.1.02,6]undeca-2(6),4-diene-7-carboxamide.
| Compound Name | N-(2-azidoethyl)-9-oxo-10-prop-2-enoxy-3-thia-5,8,10-triazatricyclo[6.2.1.02,6]undeca-2(6),4-diene-7-carboxamide |
|---|---|
| PubChem CID | 129275061 |
| Molecular Formula | C13H15N7O3S |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-(2-azidoethyl)-9-oxo-10-prop-2-enoxy-3-thia-5,8,10-triazatricyclo[6.2.1.02,6]undeca-2(6),4-diene-7-carboxamide |
| SMILES | C=CCON1C(=O)N2CC1c1scnc1C2C(=O)NCCN=[N+]=[N-] |
| InChI | InChI=1S/C13H15N7O3S/c1-2-5-23-20-8-6-19(13(20)22)10(9-11(8)24-7-16-9)12(21)15-3-4-17-18-14/h2,7-8,10H,1,3-6H2,(H,15,21) |
| InChIKey | RHJHWOALPHVOBA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 123.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|