C13H15BrN4O3S — CID 129275068
(1S,7S)-N-(2-bromoethyl)-9-oxo-10-prop-2-enoxy-3-thia-5,8,10-triazatricyclo[6.2.1.02,6]undeca-2(6),4-diene-7-carboxamide (PubChem CID 129275068) has the molecular formula C13H15BrN4O3S and a molecular weight of 387.26 g/mol. Its IUPAC name is (1S,7S)-N-(2-bromoethyl)-9-oxo-10-prop-2-enoxy-3-thia-5,8,10-triazatricyclo[6.2.1.02,6]undeca-2(6),4-diene-7-carboxamide.
| Compound Name | (1S,7S)-N-(2-bromoethyl)-9-oxo-10-prop-2-enoxy-3-thia-5,8,10-triazatricyclo[6.2.1.02,6]undeca-2(6),4-diene-7-carboxamide |
|---|---|
| PubChem CID | 129275068 |
| Molecular Formula | C13H15BrN4O3S |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | (1S,7S)-N-(2-bromoethyl)-9-oxo-10-prop-2-enoxy-3-thia-5,8,10-triazatricyclo[6.2.1.02,6]undeca-2(6),4-diene-7-carboxamide |
| SMILES | C=CCON1C(=O)N2C[C@H]1c1scnc1[C@H]2C(=O)NCCBr |
| InChI | InChI=1S/C13H15BrN4O3S/c1-2-5-21-18-8-6-17(13(18)20)10(12(19)15-4-3-14)9-11(8)22-7-16-9/h2,7-8,10H,1,3-6H2,(H,15,19)/t8-,10-/m0/s1 |
| InChIKey | JDXGTVYPSKJTAW-WPRPVWTQSA-N |
| XLogP | 1.61 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|