About 5-butan-2-yl-3-methyl-1,3-oxazinane
5-butan-2-yl-3-methyl-1,3-oxazinane (PubChem CID 129275819) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is 5-butan-2-yl-3-methyl-1,3-oxazinane.
Molecular Properties
| Compound Name | 5-butan-2-yl-3-methyl-1,3-oxazinane |
| PubChem CID | 129275819 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 5-butan-2-yl-3-methyl-1,3-oxazinane |
| SMILES | CCC(C)C1COCN(C)C1 |
| InChI | InChI=1S/C9H19NO/c1-4-8(2)9-5-10(3)7-11-6-9/h8-9H,4-7H2,1-3H3 |
| InChIKey | ZECOGFMDXDNGJS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-butan-2-yl-3-methyl-1,3-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-yl-3-methyl-1,3-oxazinane?
The IUPAC name of 5-butan-2-yl-3-methyl-1,3-oxazinane (CID 129275819) is 5-butan-2-yl-3-methyl-1,3-oxazinane.
What is the SMILES notation for 5-butan-2-yl-3-methyl-1,3-oxazinane?
The canonical SMILES for 5-butan-2-yl-3-methyl-1,3-oxazinane is CCC(C)C1COCN(C)C1.
What is the InChIKey of 5-butan-2-yl-3-methyl-1,3-oxazinane?
The InChIKey is ZECOGFMDXDNGJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO/c1-4-8(2)9-5-10(3)7-11-6-9/h8-9H,4-7H2,1-3H3.
What are the key properties of 5-butan-2-yl-3-methyl-1,3-oxazinane?
5-butan-2-yl-3-methyl-1,3-oxazinane has a molecular weight of 157.26 g/mol, XLogP of 1.57, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yl-3-methyl-1,3-oxazinane is sourced from PubChem (CID 129275819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).