C23H33F3N2 — CID 129275940
N-[[4-[1-[(4,4-difluoro-5-methylhex-1-en-3-ylidene)amino]ethenyl]-2-methylphenyl]methyl]-3-fluoro-3-methylpentan-1-amine (PubChem CID 129275940) has the molecular formula C23H33F3N2 and a molecular weight of 394.53 g/mol. Its IUPAC name is N-[[4-[1-[(4,4-difluoro-5-methylhex-1-en-3-ylidene)amino]ethenyl]-2-methylphenyl]methyl]-3-fluoro-3-methylpentan-1-amine.
| Compound Name | N-[[4-[1-[(4,4-difluoro-5-methylhex-1-en-3-ylidene)amino]ethenyl]-2-methylphenyl]methyl]-3-fluoro-3-methylpentan-1-amine |
|---|---|
| PubChem CID | 129275940 |
| Molecular Formula | C23H33F3N2 |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | N-[[4-[1-[(4,4-difluoro-5-methylhex-1-en-3-ylidene)amino]ethenyl]-2-methylphenyl]methyl]-3-fluoro-3-methylpentan-1-amine |
| SMILES | C=C/C(=N\C(=C)c1ccc(CNCCC(C)(F)CC)c(C)c1)C(F)(F)C(C)C |
| InChI | InChI=1S/C23H33F3N2/c1-8-21(23(25,26)16(3)4)28-18(6)19-10-11-20(17(5)14-19)15-27-13-12-22(7,24)9-2/h8,10-11,14,16,27H,1,6,9,12-13,15H2,2-5,7H3/b28-21+ |
| InChIKey | XIRNPOKUNAUBCB-SGWCAAJKSA-N |
| XLogP | 6.50 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|