About 4,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde
4,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 129276239) has the molecular formula C7H8O3
and a molecular weight of 140.14 g/mol. Its IUPAC name is 4,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 4,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde |
| PubChem CID | 129276239 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | 4,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | O=CC1C=CC(O)=C(O)C1 |
| InChI | InChI=1S/C7H8O3/c8-4-5-1-2-6(9)7(10)3-5/h1-2,4-5,9-10H,3H2 |
| InChIKey | CEGBCYIOXBFTBY-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde?
The IUPAC name of 4,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde (CID 129276239) is 4,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde.
What is the SMILES notation for 4,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde?
The canonical SMILES for 4,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde is O=CC1C=CC(O)=C(O)C1.
What is the InChIKey of 4,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde?
The InChIKey is CEGBCYIOXBFTBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3/c8-4-5-1-2-6(9)7(10)3-5/h1-2,4-5,9-10H,3H2.
What are the key properties of 4,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde?
4,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde has a molecular weight of 140.14 g/mol, XLogP of 1.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydroxycyclohexa-2,4-diene-1-carbaldehyde is sourced from PubChem (CID 129276239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).