C18H25F3N2O — CID 129276297
(2E,5E)-N-[4-(3,3-difluoroazetidin-1-yl)cyclohexyl]-6-fluoro-2-methyl-4-methylidenehepta-2,5-dienamide (PubChem CID 129276297) has the molecular formula C18H25F3N2O and a molecular weight of 342.41 g/mol. Its IUPAC name is (2E,5E)-N-[4-(3,3-difluoroazetidin-1-yl)cyclohexyl]-6-fluoro-2-methyl-4-methylidenehepta-2,5-dienamide.
| Compound Name | (2E,5E)-N-[4-(3,3-difluoroazetidin-1-yl)cyclohexyl]-6-fluoro-2-methyl-4-methylidenehepta-2,5-dienamide |
|---|---|
| PubChem CID | 129276297 |
| Molecular Formula | C18H25F3N2O |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (2E,5E)-N-[4-(3,3-difluoroazetidin-1-yl)cyclohexyl]-6-fluoro-2-methyl-4-methylidenehepta-2,5-dienamide |
| SMILES | C=C(/C=C(\C)F)/C=C(\C)C(=O)NC1CCC(N2CC(F)(F)C2)CC1 |
| InChI | InChI=1S/C18H25F3N2O/c1-12(9-14(3)19)8-13(2)17(24)22-15-4-6-16(7-5-15)23-10-18(20,21)11-23/h8-9,15-16H,1,4-7,10-11H2,2-3H3,(H,22,24)/b13-8+,14-9+ |
| InChIKey | NGDFWJCKDAVZNE-UQNWOCKMSA-N |
| XLogP | 3.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|