C15H18NO2P — CID 129276355
ethyl 5,6,7-trimethyl-8-phosphanylquinoline-3-carboxylate (PubChem CID 129276355) has the molecular formula C15H18NO2P and a molecular weight of 275.29 g/mol. Its IUPAC name is ethyl 5,6,7-trimethyl-8-phosphanylquinoline-3-carboxylate.
| Compound Name | ethyl 5,6,7-trimethyl-8-phosphanylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 129276355 |
| Molecular Formula | C15H18NO2P |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | ethyl 5,6,7-trimethyl-8-phosphanylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(P)c(C)c(C)c(C)c2c1 |
| InChI | InChI=1S/C15H18NO2P/c1-5-18-15(17)11-6-12-9(3)8(2)10(4)14(19)13(12)16-7-11/h6-7H,5,19H2,1-4H3 |
| InChIKey | ABJOFEONYUUFMB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|