C28H44O10 — CID 129276417
8,12-bis(butoxymethoxy)-2,4-dihydroxy-6-(hydroxymethyl)-3,7,11-trimethyl-13-oxatetracyclo[5.5.3.01,8.02,6]pentadec-3-ene-5,14-dione (PubChem CID 129276417) has the molecular formula C28H44O10 and a molecular weight of 540.65 g/mol. Its IUPAC name is 8,12-bis(butoxymethoxy)-2,4-dihydroxy-6-(hydroxymethyl)-3,7,11-trimethyl-13-oxatetracyclo[5.5.3.01,8.02,6]pentadec-3-ene-5,14-dione.
| Compound Name | 8,12-bis(butoxymethoxy)-2,4-dihydroxy-6-(hydroxymethyl)-3,7,11-trimethyl-13-oxatetracyclo[5.5.3.01,8.02,6]pentadec-3-ene-5,14-dione |
|---|---|
| PubChem CID | 129276417 |
| Molecular Formula | C28H44O10 |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | 8,12-bis(butoxymethoxy)-2,4-dihydroxy-6-(hydroxymethyl)-3,7,11-trimethyl-13-oxatetracyclo[5.5.3.01,8.02,6]pentadec-3-ene-5,14-dione |
| SMILES | CCCCOCOC1C(C)CCC2(OCOCCCC)C3(C)CC(=O)OC12C1(O)C(C)=C(O)C(=O)C31CO |
| InChI | InChI=1S/C28H44O10/c1-6-8-12-34-16-36-23-18(3)10-11-26(37-17-35-13-9-7-2)24(5)14-20(30)38-28(23,26)27(33)19(4)21(31)22(32)25(24,27)15-29/h18,23,29,31,33H,6-17H2,1-5H3 |
| InChIKey | ORNQQKULEGPMII-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|