C14H14F3N — CID 129276493
(2E)-5-ethenyl-2-[(2Z)-2-(2,2,2-trifluoroethyl)penta-2,4-dienylidene]-3H-pyridine (PubChem CID 129276493) has the molecular formula C14H14F3N and a molecular weight of 253.27 g/mol. Its IUPAC name is (2E)-5-ethenyl-2-[(2Z)-2-(2,2,2-trifluoroethyl)penta-2,4-dienylidene]-3H-pyridine.
| Compound Name | (2E)-5-ethenyl-2-[(2Z)-2-(2,2,2-trifluoroethyl)penta-2,4-dienylidene]-3H-pyridine |
|---|---|
| PubChem CID | 129276493 |
| Molecular Formula | C14H14F3N |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (2E)-5-ethenyl-2-[(2Z)-2-(2,2,2-trifluoroethyl)penta-2,4-dienylidene]-3H-pyridine |
| SMILES | C=C/C=C(\C=C1/CC=C(C=C)C=N1)CC(F)(F)F |
| InChI | InChI=1S/C14H14F3N/c1-3-5-12(9-14(15,16)17)8-13-7-6-11(4-2)10-18-13/h3-6,8,10H,1-2,7,9H2/b12-5+,13-8+ |
| InChIKey | NJQRKKUJPVNMPV-MLQRZSMFSA-N |
| XLogP | 4.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|