C19H29F3N2O — CID 129276506
(2E,5E)-N-[4-[[[(2S)-1,1-difluoropropan-2-yl]amino]methyl]cyclohexyl]-6-fluoro-2-methyl-4-methylidenehepta-2,5-dienamide (PubChem CID 129276506) has the molecular formula C19H29F3N2O and a molecular weight of 358.45 g/mol. Its IUPAC name is (2E,5E)-N-[4-[[[(2S)-1,1-difluoropropan-2-yl]amino]methyl]cyclohexyl]-6-fluoro-2-methyl-4-methylidenehepta-2,5-dienamide.
| Compound Name | (2E,5E)-N-[4-[[[(2S)-1,1-difluoropropan-2-yl]amino]methyl]cyclohexyl]-6-fluoro-2-methyl-4-methylidenehepta-2,5-dienamide |
|---|---|
| PubChem CID | 129276506 |
| Molecular Formula | C19H29F3N2O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | (2E,5E)-N-[4-[[[(2S)-1,1-difluoropropan-2-yl]amino]methyl]cyclohexyl]-6-fluoro-2-methyl-4-methylidenehepta-2,5-dienamide |
| SMILES | C=C(/C=C(\C)F)/C=C(\C)C(=O)NC1CCC(CN[C@@H](C)C(F)F)CC1 |
| InChI | InChI=1S/C19H29F3N2O/c1-12(10-14(3)20)9-13(2)19(25)24-17-7-5-16(6-8-17)11-23-15(4)18(21)22/h9-10,15-18,23H,1,5-8,11H2,2-4H3,(H,24,25)/b13-9+,14-10+/t15-,16?,17?/m0/s1 |
| InChIKey | IUZZSURGTPWWQW-OXPRLKTFSA-N |
| XLogP | 4.28 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|