C12H22N2 — CID 129276642
(6Z,8Z)-N,3-dimethyl-9-(methylideneamino)nona-6,8-dien-1-amine (PubChem CID 129276642) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is (6Z,8Z)-N,3-dimethyl-9-(methylideneamino)nona-6,8-dien-1-amine.
| Compound Name | (6Z,8Z)-N,3-dimethyl-9-(methylideneamino)nona-6,8-dien-1-amine |
|---|---|
| PubChem CID | 129276642 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | (6Z,8Z)-N,3-dimethyl-9-(methylideneamino)nona-6,8-dien-1-amine |
| SMILES | C=N/C=C\C=C/CCC(C)CCNC |
| InChI | InChI=1S/C12H22N2/c1-12(9-11-14-3)8-6-4-5-7-10-13-2/h4-5,7,10,12,14H,2,6,8-9,11H2,1,3H3/b5-4-,10-7- |
| InChIKey | FTSWRXYDRMJPKK-WKBXPBOGSA-N |
| XLogP | 2.78 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|